C27H27F6N5O6S — CID 158720682
N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide;methane;2,2,2-trifluoroacetic acid (PubChem CID 158720682) has the molecular formula C27H27F6N5O6S and a molecular weight of 663.60 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide;methane;2,2,2-trifluoroacetic acid.
| Compound Name | N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide;methane;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158720682 |
| Molecular Formula | C27H27F6N5O6S |
| Molecular Weight | 663.60 g/mol |
| Exact Mass | 663.16 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-N'-[(1S)-1-[4-pyridin-4-ylsulfonyl-3-(trifluoromethyl)phenyl]ethyl]propanediamide;methane;2,2,2-trifluoroacetic acid |
| SMILES | C.O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(NC(=O)CC(=O)N[C@@H](C)c2ccc(S(=O)(=O)c3ccncc3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C24H22F3N5O4S.C2HF3O2.CH4/c1-14(31-21(33)13-22(34)32-17-5-2-15(3-6-17)23(28)29)16-4-7-20(19(12-16)24(25,26)27)37(35,36)18-8-10-30-11-9-18;3-2(4,5)1(6)7;/h2-12,14H,13H2,1H3,(H3,28,29)(H,31,33)(H,32,34);(H,6,7);1H4/t14-;;/m0../s1 |
| InChIKey | DHXFWPNMWMVHEJ-UTLKBRERSA-N |
| XLogP | 4.69 |
| TPSA | 192.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.60 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|