C25H29F3N4O5 — CID 59506164
ethyl 4-[4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-2-(trifluoromethyl)phenoxy]butanoate (PubChem CID 59506164) has the molecular formula C25H29F3N4O5 and a molecular weight of 522.52 g/mol. Its IUPAC name is ethyl 4-[4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-2-(trifluoromethyl)phenoxy]butanoate.
| Compound Name | ethyl 4-[4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-2-(trifluoromethyl)phenoxy]butanoate |
|---|---|
| PubChem CID | 59506164 |
| Molecular Formula | C25H29F3N4O5 |
| Molecular Weight | 522.52 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | ethyl 4-[4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-2-(trifluoromethyl)phenoxy]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)NC(C)c2ccc(OCCCC(=O)OCC)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C25H29F3N4O5/c1-3-36-23(35)5-4-12-37-20-11-8-17(13-19(20)25(26,27)28)15(2)31-21(33)14-22(34)32-18-9-6-16(7-10-18)24(29)30/h6-11,13,15H,3-5,12,14H2,1-2H3,(H3,29,30)(H,31,33)(H,32,34) |
| InChIKey | CORUGOBXSNWDNK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 143.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.52 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|