C23H25F3N4O5 — CID 140554230
4-[2-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-4-(trifluoromethyl)phenoxy]butanoic acid (PubChem CID 140554230) has the molecular formula C23H25F3N4O5 and a molecular weight of 494.47 g/mol. Its IUPAC name is 4-[2-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-4-(trifluoromethyl)phenoxy]butanoic acid.
| Compound Name | 4-[2-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-4-(trifluoromethyl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 140554230 |
| Molecular Formula | C23H25F3N4O5 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 4-[2-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]-4-(trifluoromethyl)phenoxy]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)NC(C)c2cc(C(F)(F)F)ccc2OCCCC(=O)O)cc1 |
| InChI | InChI=1S/C23H25F3N4O5/c1-13(29-19(31)12-20(32)30-16-7-4-14(5-8-16)22(27)28)17-11-15(23(24,25)26)6-9-18(17)35-10-2-3-21(33)34/h4-9,11,13H,2-3,10,12H2,1H3,(H3,27,28)(H,29,31)(H,30,32)(H,33,34) |
| InChIKey | CFXORSVKRKKOBE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 154.60 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|