C27H34BrN5O5 — CID 59506261
ethyl 2-[4-[2-bromo-4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]phenoxy]piperidin-1-yl]acetate (PubChem CID 59506261) has the molecular formula C27H34BrN5O5 and a molecular weight of 588.50 g/mol. Its IUPAC name is ethyl 2-[4-[2-bromo-4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]phenoxy]piperidin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[2-bromo-4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]phenoxy]piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 59506261 |
| Molecular Formula | C27H34BrN5O5 |
| Molecular Weight | 588.50 g/mol |
| Exact Mass | 587.17 |
| IUPAC Name | ethyl 2-[4-[2-bromo-4-[1-[[3-(4-carbamimidoylanilino)-3-oxopropanoyl]amino]ethyl]phenoxy]piperidin-1-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)CC(=O)NC(C)c2ccc(OC3CCN(CC(=O)OCC)CC3)c(Br)c2)cc1 |
| InChI | InChI=1S/C27H34BrN5O5/c1-3-37-26(36)16-33-12-10-21(11-13-33)38-23-9-6-19(14-22(23)28)17(2)31-24(34)15-25(35)32-20-7-4-18(5-8-20)27(29)30/h4-9,14,17,21H,3,10-13,15-16H2,1-2H3,(H3,29,30)(H,31,34)(H,32,35) |
| InChIKey | MHDVKRHGAZCXJD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|