C12H15F3N2O2 — CID 115468119
4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 115468119) has the molecular formula C12H15F3N2O2 and a molecular weight of 276.26 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | 4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 115468119 |
| Molecular Formula | C12H15F3N2O2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCOCC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H15F3N2O2/c1-2-18-5-6-19-10-4-3-8(11(16)17)7-9(10)12(13,14)15/h3-4,7H,2,5-6H2,1H3,(H3,16,17) |
| InChIKey | AAUPSPBNHNHVAA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|