C10H10BrF3N2O — CID 82955098
3-bromo-4-(3,3,3-trifluoropropoxy)benzenecarboximidamide (PubChem CID 82955098) has the molecular formula C10H10BrF3N2O and a molecular weight of 311.10 g/mol. Its IUPAC name is 3-bromo-4-(3,3,3-trifluoropropoxy)benzenecarboximidamide.
| Compound Name | 3-bromo-4-(3,3,3-trifluoropropoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 82955098 |
| Molecular Formula | C10H10BrF3N2O |
| Molecular Weight | 311.10 g/mol |
| Exact Mass | 309.99 |
| IUPAC Name | 3-bromo-4-(3,3,3-trifluoropropoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C10H10BrF3N2O/c11-7-5-6(9(15)16)1-2-8(7)17-4-3-10(12,13)14/h1-2,5H,3-4H2,(H3,15,16) |
| InChIKey | RXQPFWZQPDKCEB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.10 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|