C10H10F4N2O — CID 64566908
2-fluoro-6-(3,3,3-trifluoropropoxy)benzenecarboximidamide (PubChem CID 64566908) has the molecular formula C10H10F4N2O and a molecular weight of 250.19 g/mol. Its IUPAC name is 2-fluoro-6-(3,3,3-trifluoropropoxy)benzenecarboximidamide.
| Compound Name | 2-fluoro-6-(3,3,3-trifluoropropoxy)benzenecarboximidamide |
|---|---|
| PubChem CID | 64566908 |
| Molecular Formula | C10H10F4N2O |
| Molecular Weight | 250.19 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-fluoro-6-(3,3,3-trifluoropropoxy)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(F)cccc1OCCC(F)(F)F |
| InChI | InChI=1S/C10H10F4N2O/c11-6-2-1-3-7(8(6)9(15)16)17-5-4-10(12,13)14/h1-3H,4-5H2,(H3,15,16) |
| InChIKey | WKISXXYBDIPKBI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.19 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|