C11H14FN3O2 — CID 82240685
2-(2-carbamimidoyl-3-fluorophenoxy)-N,N-dimethylacetamide (PubChem CID 82240685) has the molecular formula C11H14FN3O2 and a molecular weight of 239.25 g/mol. Its IUPAC name is 2-(2-carbamimidoyl-3-fluorophenoxy)-N,N-dimethylacetamide.
| Compound Name | 2-(2-carbamimidoyl-3-fluorophenoxy)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 82240685 |
| Molecular Formula | C11H14FN3O2 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(2-carbamimidoyl-3-fluorophenoxy)-N,N-dimethylacetamide |
| SMILES | [H]/N=C(\N)c1c(F)cccc1OCC(=O)N(C)C |
| InChI | InChI=1S/C11H14FN3O2/c1-15(2)9(16)6-17-8-5-3-4-7(12)10(8)11(13)14/h3-5H,6H2,1-2H3,(H3,13,14) |
| InChIKey | JDPDWCGJUONLOY-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|