C11H13ClN2O2S — CID 113277323
2-(2-carbamothioyl-3-chlorophenoxy)-N,N-dimethylacetamide (PubChem CID 113277323) has the molecular formula C11H13ClN2O2S and a molecular weight of 272.76 g/mol. Its IUPAC name is 2-(2-carbamothioyl-3-chlorophenoxy)-N,N-dimethylacetamide.
| Compound Name | 2-(2-carbamothioyl-3-chlorophenoxy)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 113277323 |
| Molecular Formula | C11H13ClN2O2S |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.04 |
| IUPAC Name | 2-(2-carbamothioyl-3-chlorophenoxy)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1cccc(Cl)c1C(N)=S |
| InChI | InChI=1S/C11H13ClN2O2S/c1-14(2)9(15)6-16-8-5-3-4-7(12)10(8)11(13)17/h3-5H,6H2,1-2H3,(H2,13,17) |
| InChIKey | OSNKVPQFPHHVGP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|