C10H11Cl2NO2 — CID 78765476
2-(2,6-dichlorophenoxy)-N,N-dimethylacetamide (PubChem CID 78765476) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is 2-(2,6-dichlorophenoxy)-N,N-dimethylacetamide.
| Compound Name | 2-(2,6-dichlorophenoxy)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 78765476 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-(2,6-dichlorophenoxy)-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)COc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C10H11Cl2NO2/c1-13(2)9(14)6-15-10-7(11)4-3-5-8(10)12/h3-5H,6H2,1-2H3 |
| InChIKey | DRMPKCSMQVXTPP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |