C12H16ClNO2S — CID 113277332
2-chloro-6-(3-hydroxy-3-methylbutoxy)benzenecarbothioamide (PubChem CID 113277332) has the molecular formula C12H16ClNO2S and a molecular weight of 273.78 g/mol. Its IUPAC name is 2-chloro-6-(3-hydroxy-3-methylbutoxy)benzenecarbothioamide.
| Compound Name | 2-chloro-6-(3-hydroxy-3-methylbutoxy)benzenecarbothioamide |
|---|---|
| PubChem CID | 113277332 |
| Molecular Formula | C12H16ClNO2S |
| Molecular Weight | 273.78 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 2-chloro-6-(3-hydroxy-3-methylbutoxy)benzenecarbothioamide |
| SMILES | CC(C)(O)CCOc1cccc(Cl)c1C(N)=S |
| InChI | InChI=1S/C12H16ClNO2S/c1-12(2,15)6-7-16-9-5-3-4-8(13)10(9)11(14)17/h3-5,15H,6-7H2,1-2H3,(H2,14,17) |
| InChIKey | WGHHEDVGBUWBKU-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|