C12H17N3O3 — CID 82253483
2-(2-carbamimidoyl-6-methoxyphenoxy)-N,N-dimethylacetamide (PubChem CID 82253483) has the molecular formula C12H17N3O3 and a molecular weight of 251.29 g/mol. Its IUPAC name is 2-(2-carbamimidoyl-6-methoxyphenoxy)-N,N-dimethylacetamide.
| Compound Name | 2-(2-carbamimidoyl-6-methoxyphenoxy)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 82253483 |
| Molecular Formula | C12H17N3O3 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-(2-carbamimidoyl-6-methoxyphenoxy)-N,N-dimethylacetamide |
| SMILES | [H]/N=C(\N)c1cccc(OC)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C12H17N3O3/c1-15(2)10(16)7-18-11-8(12(13)14)5-4-6-9(11)17-3/h4-6H,7H2,1-3H3,(H3,13,14) |
| InChIKey | LEMPMORERQFLND-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|