C12H13F4NO2S — CID 61490971
2-fluoro-6-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarbothioamide (PubChem CID 61490971) has the molecular formula C12H13F4NO2S and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-fluoro-6-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarbothioamide.
| Compound Name | 2-fluoro-6-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarbothioamide |
|---|---|
| PubChem CID | 61490971 |
| Molecular Formula | C12H13F4NO2S |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-fluoro-6-[3-(2,2,2-trifluoroethoxy)propoxy]benzenecarbothioamide |
| SMILES | NC(=S)c1c(F)cccc1OCCCOCC(F)(F)F |
| InChI | InChI=1S/C12H13F4NO2S/c13-8-3-1-4-9(10(8)11(17)20)19-6-2-5-18-7-12(14,15)16/h1,3-4H,2,5-7H2,(H2,17,20) |
| InChIKey | LYEUOIBEDQBUGR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|