C12H14F3NO2S — CID 115467936
4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarbothioamide (PubChem CID 115467936) has the molecular formula C12H14F3NO2S and a molecular weight of 293.31 g/mol. Its IUPAC name is 4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 115467936 |
| Molecular Formula | C12H14F3NO2S |
| Molecular Weight | 293.31 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 4-(2-ethoxyethoxy)-3-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CCOCCOc1ccc(C(N)=S)cc1C(F)(F)F |
| InChI | InChI=1S/C12H14F3NO2S/c1-2-17-5-6-18-10-4-3-8(11(16)19)7-9(10)12(13,14)15/h3-4,7H,2,5-6H2,1H3,(H2,16,19) |
| InChIKey | FFYJODWUNBYGDA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|