C13H16F3NO2S — CID 115467987
4-(3-hydroxy-3-methylbutoxy)-3-(trifluoromethyl)benzenecarbothioamide (PubChem CID 115467987) has the molecular formula C13H16F3NO2S and a molecular weight of 307.34 g/mol. Its IUPAC name is 4-(3-hydroxy-3-methylbutoxy)-3-(trifluoromethyl)benzenecarbothioamide.
| Compound Name | 4-(3-hydroxy-3-methylbutoxy)-3-(trifluoromethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 115467987 |
| Molecular Formula | C13H16F3NO2S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 4-(3-hydroxy-3-methylbutoxy)-3-(trifluoromethyl)benzenecarbothioamide |
| SMILES | CC(C)(O)CCOc1ccc(C(N)=S)cc1C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2S/c1-12(2,18)5-6-19-10-4-3-8(11(17)20)7-9(10)13(14,15)16/h3-4,7,18H,5-6H2,1-2H3,(H2,17,20) |
| InChIKey | HMUQYBNBXRSXGD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|