C24H29N5O7 — CID 11649002
2-[4-carbamimidoyl-2-[2-[4-(1-carbamimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid (PubChem CID 11649002) has the molecular formula C24H29N5O7 and a molecular weight of 499.52 g/mol. Its IUPAC name is 2-[4-carbamimidoyl-2-[2-[4-(1-carbamimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid.
| Compound Name | 2-[4-carbamimidoyl-2-[2-[4-(1-carbamimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid |
|---|---|
| PubChem CID | 11649002 |
| Molecular Formula | C24H29N5O7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[4-carbamimidoyl-2-[2-[4-(1-carbamimidoylpiperidin-4-yl)oxybenzoyl]oxyethoxy]phenoxy]acetic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCC(=O)O)c(OCCOC(=O)c2ccc(OC3CCN(/C(N)=N/[H])CC3)cc2)c1 |
| InChI | InChI=1S/C24H29N5O7/c25-22(26)16-3-6-19(35-14-21(30)31)20(13-16)33-11-12-34-23(32)15-1-4-17(5-2-15)36-18-7-9-29(10-8-18)24(27)28/h1-6,13,18H,7-12,14H2,(H3,25,26)(H3,27,28)(H,30,31) |
| InChIKey | MZESHCDHGDQYHS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 194.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|