C25H31N5O6 — CID 140522737
2-(1-amino-1-imino-3-oxo-3-phenylmethoxypropan-2-yl)oxyethyl 4-(1-carbamimidoylpiperidin-4-yl)oxybenzoate (PubChem CID 140522737) has the molecular formula C25H31N5O6 and a molecular weight of 497.55 g/mol. Its IUPAC name is 2-(1-amino-1-imino-3-oxo-3-phenylmethoxypropan-2-yl)oxyethyl 4-(1-carbamimidoylpiperidin-4-yl)oxybenzoate.
| Compound Name | 2-(1-amino-1-imino-3-oxo-3-phenylmethoxypropan-2-yl)oxyethyl 4-(1-carbamimidoylpiperidin-4-yl)oxybenzoate |
|---|---|
| PubChem CID | 140522737 |
| Molecular Formula | C25H31N5O6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | 2-(1-amino-1-imino-3-oxo-3-phenylmethoxypropan-2-yl)oxyethyl 4-(1-carbamimidoylpiperidin-4-yl)oxybenzoate |
| SMILES | [H]/N=C(\N)C(OCCOC(=O)c1ccc(OC2CCN(/C(N)=N/[H])CC2)cc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H31N5O6/c26-22(27)21(24(32)35-16-17-4-2-1-3-5-17)33-14-15-34-23(31)18-6-8-19(9-7-18)36-20-10-12-30(13-11-20)25(28)29/h1-9,20-21H,10-16H2,(H3,26,27)(H3,28,29) |
| InChIKey | VQDPTINDGZXJPA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 174.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|