C32H33F3N4O7 — CID 67107855
benzyl 4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxycarbonyl]phenoxy]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 67107855) has the molecular formula C32H33F3N4O7 and a molecular weight of 642.63 g/mol. Its IUPAC name is benzyl 4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxycarbonyl]phenoxy]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl 4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxycarbonyl]phenoxy]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67107855 |
| Molecular Formula | C32H33F3N4O7 |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.23 |
| IUPAC Name | benzyl 4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxycarbonyl]phenoxy]piperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)N1CCc2ccc(OC(=O)c3ccc(OC4CCN(C(=O)OCc5ccccc5)CC4)cc3)cc2C1 |
| InChI | InChI=1S/C30H32N4O5.C2HF3O2/c31-29(32)34-15-12-22-6-11-27(18-24(22)19-34)39-28(35)23-7-9-25(10-8-23)38-26-13-16-33(17-14-26)30(36)37-20-21-4-2-1-3-5-21;3-2(4,5)1(6)7/h1-11,18,26H,12-17,19-20H2,(H3,31,32);(H,6,7) |
| InChIKey | SKASVXOFVLAYJM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 155.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|