C28H38N6O5S — CID 54078138
ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-[4-(1-propanimidoylpiperidin-4-yl)oxyphenyl]sulfonylamino]acetate (PubChem CID 54078138) has the molecular formula C28H38N6O5S and a molecular weight of 570.72 g/mol. Its IUPAC name is ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-[4-(1-propanimidoylpiperidin-4-yl)oxyphenyl]sulfonylamino]acetate.
| Compound Name | ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-[4-(1-propanimidoylpiperidin-4-yl)oxyphenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 54078138 |
| Molecular Formula | C28H38N6O5S |
| Molecular Weight | 570.72 g/mol |
| Exact Mass | 570.26 |
| IUPAC Name | ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-[4-(1-propanimidoylpiperidin-4-yl)oxyphenyl]sulfonylamino]acetate |
| SMILES | [H]/N=C(\N)N1CCc2ccc(N(CC(=O)OCC)S(=O)(=O)c3ccc(OC4CCN(/C(CC)=N/[H])CC4)cc3)cc2C1 |
| InChI | InChI=1S/C28H38N6O5S/c1-3-26(29)32-15-12-24(13-16-32)39-23-7-9-25(10-8-23)40(36,37)34(19-27(35)38-4-2)22-6-5-20-11-14-33(28(30)31)18-21(20)17-22/h5-10,17,24,29H,3-4,11-16,18-19H2,1-2H3,(H3,30,31)/b29-26+ |
| InChIKey | MLDRYTGXMUQLNV-PBBVDAKRSA-N |
| XLogP | 2.93 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.72 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|