C25H35N6O4S+ — CID 54315890
7-[[4-(1-ethanimidoylpiperidin-1-ium-1-yl)oxyphenyl]sulfonyl-(2-hydroxyethyl)amino]-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 54315890) has the molecular formula C25H35N6O4S+ and a molecular weight of 515.66 g/mol. Its IUPAC name is 7-[[4-(1-ethanimidoylpiperidin-1-ium-1-yl)oxyphenyl]sulfonyl-(2-hydroxyethyl)amino]-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | 7-[[4-(1-ethanimidoylpiperidin-1-ium-1-yl)oxyphenyl]sulfonyl-(2-hydroxyethyl)amino]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 54315890 |
| Molecular Formula | C25H35N6O4S+ |
| Molecular Weight | 515.66 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 7-[[4-(1-ethanimidoylpiperidin-1-ium-1-yl)oxyphenyl]sulfonyl-(2-hydroxyethyl)amino]-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N)N1CCc2ccc(N(CCO)S(=O)(=O)c3ccc(O[N+]4(/C(C)=N/[H])CCCCC4)cc3)cc2C1 |
| InChI | InChI=1S/C25H35N6O4S/c1-19(26)31(14-3-2-4-15-31)35-23-7-9-24(10-8-23)36(33,34)30(13-16-32)22-6-5-20-11-12-29(25(27)28)18-21(20)17-22/h5-10,17,26,32H,2-4,11-16,18H2,1H3,(H3,27,28)/q+1/b26-19+ |
| InChIKey | FCOOTIDYWNOGAT-LGUFXXKBSA-N |
| XLogP | 2.42 |
| TPSA | 143.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|