C26H31ClN4O3S — CID 18536532
7-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydrochloride (PubChem CID 18536532) has the molecular formula C26H31ClN4O3S and a molecular weight of 515.08 g/mol. Its IUPAC name is 7-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydrochloride.
| Compound Name | 7-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 18536532 |
| Molecular Formula | C26H31ClN4O3S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.18 |
| IUPAC Name | 7-[(1-naphthalen-2-ylsulfonylpiperidin-4-yl)methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)N1CCc2ccc(OCC3CCN(S(=O)(=O)c4ccc5ccccc5c4)CC3)cc2C1 |
| InChI | InChI=1S/C26H30N4O3S.ClH/c27-26(28)29-12-11-21-5-7-24(15-23(21)17-29)33-18-19-9-13-30(14-10-19)34(31,32)25-8-6-20-3-1-2-4-22(20)16-25;/h1-8,15-16,19H,9-14,17-18H2,(H3,27,28);1H |
| InChIKey | ZSJJXKSIBUCSRC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|