C23H33Cl2N5O — CID 10298614
7-[[1-[(3-aminophenyl)methyl]piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;dihydrochloride (PubChem CID 10298614) has the molecular formula C23H33Cl2N5O and a molecular weight of 466.46 g/mol. Its IUPAC name is 7-[[1-[(3-aminophenyl)methyl]piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;dihydrochloride.
| Compound Name | 7-[[1-[(3-aminophenyl)methyl]piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 10298614 |
| Molecular Formula | C23H33Cl2N5O |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 7-[[1-[(3-aminophenyl)methyl]piperidin-4-yl]methoxy]-3,4-dihydro-1H-isoquinoline-2-carboximidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)N1CCc2ccc(OCC3CCN(Cc4cccc(N)c4)CC3)cc2C1 |
| InChI | InChI=1S/C23H31N5O.2ClH/c24-21-3-1-2-18(12-21)14-27-9-6-17(7-10-27)16-29-22-5-4-19-8-11-28(23(25)26)15-20(19)13-22;;/h1-5,12-13,17H,6-11,14-16,24H2,(H3,25,26);2*1H |
| InChIKey | MGFPABFEPREJFN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 91.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|