C26H34N6O5 — CID 139812254
ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-carbamimidoylpiperidin-4-yl)oxy-3-hydroxyphenyl]acetate (PubChem CID 139812254) has the molecular formula C26H34N6O5 and a molecular weight of 510.60 g/mol. Its IUPAC name is ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-carbamimidoylpiperidin-4-yl)oxy-3-hydroxyphenyl]acetate.
| Compound Name | ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-carbamimidoylpiperidin-4-yl)oxy-3-hydroxyphenyl]acetate |
|---|---|
| PubChem CID | 139812254 |
| Molecular Formula | C26H34N6O5 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-carbamimidoylpiperidin-4-yl)oxy-3-hydroxyphenyl]acetate |
| SMILES | [H]/N=C(\N)N1CCC(Oc2ccc(C(Oc3ccc4c(c3)CN(/C(N)=N/[H])CC4)C(=O)OCC)cc2O)CC1 |
| InChI | InChI=1S/C26H34N6O5/c1-2-35-24(34)23(37-20-5-3-16-7-10-32(26(29)30)15-18(16)13-20)17-4-6-22(21(33)14-17)36-19-8-11-31(12-9-19)25(27)28/h3-6,13-14,19,23,33H,2,7-12,15H2,1H3,(H3,27,28)(H3,29,30) |
| InChIKey | MNFZBDGWSYEVIT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 171.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|