C24H30N6O4 — CID 139812290
ethyl 2-[4-[(2-amino-1,4,5,6-tetrahydropyrimidin-5-yl)oxy]phenyl]-2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]acetate (PubChem CID 139812290) has the molecular formula C24H30N6O4 and a molecular weight of 466.54 g/mol. Its IUPAC name is ethyl 2-[4-[(2-amino-1,4,5,6-tetrahydropyrimidin-5-yl)oxy]phenyl]-2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]acetate.
| Compound Name | ethyl 2-[4-[(2-amino-1,4,5,6-tetrahydropyrimidin-5-yl)oxy]phenyl]-2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]acetate |
|---|---|
| PubChem CID | 139812290 |
| Molecular Formula | C24H30N6O4 |
| Molecular Weight | 466.54 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | ethyl 2-[4-[(2-amino-1,4,5,6-tetrahydropyrimidin-5-yl)oxy]phenyl]-2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]acetate |
| SMILES | [H]/N=C(\N)N1CCc2ccc(OC(C(=O)OCC)c3ccc(OC4CN=C(N)NC4)cc3)cc2C1 |
| InChI | InChI=1S/C24H30N6O4/c1-2-32-22(31)21(16-4-6-18(7-5-16)33-20-12-28-24(27)29-13-20)34-19-8-3-15-9-10-30(23(25)26)14-17(15)11-19/h3-8,11,20-21H,2,9-10,12-14H2,1H3,(H3,25,26)(H3,27,28,29) |
| InChIKey | LPYUBUIGHOURGU-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 148.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.54 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|