C26H33N5O5 — CID 67620014
2-[(2-carbamimidoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]acetic acid (PubChem CID 67620014) has the molecular formula C26H33N5O5 and a molecular weight of 495.58 g/mol. Its IUPAC name is 2-[(2-carbamimidoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]acetic acid.
| Compound Name | 2-[(2-carbamimidoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]acetic acid |
|---|---|
| PubChem CID | 67620014 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | 2-[(2-carbamimidoyl-6-methoxy-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl]acetic acid |
| SMILES | [H]/N=C(\C)N1CCC(Oc2ccc(C(Oc3cc4c(cc3OC)CCN(/C(N)=N/[H])C4)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C26H33N5O5/c1-16(27)30-11-8-21(9-12-30)35-20-5-3-17(4-6-20)24(25(32)33)36-23-14-19-15-31(26(28)29)10-7-18(19)13-22(23)34-2/h3-6,13-14,21,24,27H,7-12,15H2,1-2H3,(H3,28,29)(H,32,33)/b27-16+ |
| InChIKey | UWNHAIFEWMPPTA-JVWAILMASA-N |
| XLogP | 2.99 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|