C28H34N4O5 — CID 100932702
prop-2-enyl 3-[4-[1-(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-2-ethoxy-2-oxoethyl]phenoxy]pyrrolidine-1-carboxylate (PubChem CID 100932702) has the molecular formula C28H34N4O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is prop-2-enyl 3-[4-[1-(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-2-ethoxy-2-oxoethyl]phenoxy]pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl 3-[4-[1-(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-2-ethoxy-2-oxoethyl]phenoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100932702 |
| Molecular Formula | C28H34N4O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | prop-2-enyl 3-[4-[1-(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)-2-ethoxy-2-oxoethyl]phenoxy]pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C(\N)N1CCc2ccc(C(C(=O)OCC)c3ccc(OC4CCN(C(=O)OCC=C)C4)cc3)cc2C1 |
| InChI | InChI=1S/C28H34N4O5/c1-3-15-36-28(34)32-14-12-24(18-32)37-23-9-7-20(8-10-23)25(26(33)35-4-2)21-6-5-19-11-13-31(27(29)30)17-22(19)16-21/h3,5-10,16,24-25H,1,4,11-15,17-18H2,2H3,(H3,29,30) |
| InChIKey | RHJBEHQXRUJMPO-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 118.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|