C24H28N4O5 — CID 123967153
4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)methoxycarbonyl]phenoxy]piperidine-1-carboxylic acid (PubChem CID 123967153) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)methoxycarbonyl]phenoxy]piperidine-1-carboxylic acid.
| Compound Name | 4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)methoxycarbonyl]phenoxy]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123967153 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-[4-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)methoxycarbonyl]phenoxy]piperidine-1-carboxylic acid |
| SMILES | [H]/N=C(\N)N1CCc2ccc(COC(=O)c3ccc(OC4CCN(C(=O)O)CC4)cc3)cc2C1 |
| InChI | InChI=1S/C24H28N4O5/c25-23(26)28-10-7-17-2-1-16(13-19(17)14-28)15-32-22(29)18-3-5-20(6-4-18)33-21-8-11-27(12-9-21)24(30)31/h1-6,13,21H,7-12,14-15H2,(H3,25,26)(H,30,31) |
| InChIKey | SAZRRUXPENFJPC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 129.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|