C24H27N5O4 — CID 139812274
ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1H-imidazol-5-ylmethoxy)phenyl]acetate (PubChem CID 139812274) has the molecular formula C24H27N5O4 and a molecular weight of 449.51 g/mol. Its IUPAC name is ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1H-imidazol-5-ylmethoxy)phenyl]acetate.
| Compound Name | ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1H-imidazol-5-ylmethoxy)phenyl]acetate |
|---|---|
| PubChem CID | 139812274 |
| Molecular Formula | C24H27N5O4 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | ethyl 2-[(2-carbamimidoyl-3,4-dihydro-1H-isoquinolin-7-yl)oxy]-2-[4-(1H-imidazol-5-ylmethoxy)phenyl]acetate |
| SMILES | [H]/N=C(\N)N1CCc2ccc(OC(C(=O)OCC)c3ccc(OCc4cnc[nH]4)cc3)cc2C1 |
| InChI | InChI=1S/C24H27N5O4/c1-2-31-23(30)22(17-4-6-20(7-5-17)32-14-19-12-27-15-28-19)33-21-8-3-16-9-10-29(24(25)26)13-18(16)11-21/h3-8,11-12,15,22H,2,9-10,13-14H2,1H3,(H3,25,26)(H,27,28) |
| InChIKey | ZSYSFTFIEUMPBY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|