C32H40N2O8 — CID 10555247
tert-butyl 7-[2-ethoxy-2-oxo-1-[4-[(3S)-1-prop-2-enoxycarbonylpyrrolidin-3-yl]oxyphenyl]ethoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 10555247) has the molecular formula C32H40N2O8 and a molecular weight of 580.68 g/mol. Its IUPAC name is tert-butyl 7-[2-ethoxy-2-oxo-1-[4-[(3S)-1-prop-2-enoxycarbonylpyrrolidin-3-yl]oxyphenyl]ethoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-[2-ethoxy-2-oxo-1-[4-[(3S)-1-prop-2-enoxycarbonylpyrrolidin-3-yl]oxyphenyl]ethoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 10555247 |
| Molecular Formula | C32H40N2O8 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.28 |
| IUPAC Name | tert-butyl 7-[2-ethoxy-2-oxo-1-[4-[(3S)-1-prop-2-enoxycarbonylpyrrolidin-3-yl]oxyphenyl]ethoxy]-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | C=CCOC(=O)N1CC[C@H](Oc2ccc(C(Oc3ccc4c(c3)CN(C(=O)OC(C)(C)C)CC4)C(=O)OCC)cc2)C1 |
| InChI | InChI=1S/C32H40N2O8/c1-6-18-39-30(36)34-17-15-27(21-34)40-25-11-9-23(10-12-25)28(29(35)38-7-2)41-26-13-8-22-14-16-33(20-24(22)19-26)31(37)42-32(3,4)5/h6,8-13,19,27-28H,1,7,14-18,20-21H2,2-5H3/t27-,28?/m0/s1 |
| InChIKey | UFGYKIGEVWGZSG-MBMZGMDYSA-N |
| XLogP | 5.44 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|