C17H22F3N3O4 — CID 159381480
benzyl (3S)-4-carbamimidoyl-3-methylpiperidine-1-carboxylate;2,2,2-trifluoroacetic acid (PubChem CID 159381480) has the molecular formula C17H22F3N3O4 and a molecular weight of 389.37 g/mol. Its IUPAC name is benzyl (3S)-4-carbamimidoyl-3-methylpiperidine-1-carboxylate;2,2,2-trifluoroacetic acid.
| Compound Name | benzyl (3S)-4-carbamimidoyl-3-methylpiperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 159381480 |
| Molecular Formula | C17H22F3N3O4 |
| Molecular Weight | 389.37 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | benzyl (3S)-4-carbamimidoyl-3-methylpiperidine-1-carboxylate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)C1CCN(C(=O)OCc2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C15H21N3O2.C2HF3O2/c1-11-9-18(8-7-13(11)14(16)17)15(19)20-10-12-5-3-2-4-6-12;3-2(4,5)1(6)7/h2-6,11,13H,7-10H2,1H3,(H3,16,17);(H,6,7)/t11-,13?;/m1./s1 |
| InChIKey | LJWQOLBSCHQETF-ZRMPQGGQSA-N |
| XLogP | 2.85 |
| TPSA | 116.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.37 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|