C27H33N5O4 — CID 22083118
N-[2-[5-carbamimidoyl-2-[(E)-3-oxobut-1-enyl]phenoxy]ethyl]-4-(1-ethanimidoylpiperidin-4-yl)oxybenzamide (PubChem CID 22083118) has the molecular formula C27H33N5O4 and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[2-[5-carbamimidoyl-2-[(E)-3-oxobut-1-enyl]phenoxy]ethyl]-4-(1-ethanimidoylpiperidin-4-yl)oxybenzamide.
| Compound Name | N-[2-[5-carbamimidoyl-2-[(E)-3-oxobut-1-enyl]phenoxy]ethyl]-4-(1-ethanimidoylpiperidin-4-yl)oxybenzamide |
|---|---|
| PubChem CID | 22083118 |
| Molecular Formula | C27H33N5O4 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[2-[5-carbamimidoyl-2-[(E)-3-oxobut-1-enyl]phenoxy]ethyl]-4-(1-ethanimidoylpiperidin-4-yl)oxybenzamide |
| SMILES | [H]/N=C(\N)c1ccc(/C=C/C(C)=O)c(OCCNC(=O)c2ccc(OC3CCN(/C(C)=N/[H])CC3)cc2)c1 |
| InChI | InChI=1S/C27H33N5O4/c1-18(33)3-4-20-5-6-22(26(29)30)17-25(20)35-16-13-31-27(34)21-7-9-23(10-8-21)36-24-11-14-32(15-12-24)19(2)28/h3-10,17,24,28H,11-16H2,1-2H3,(H3,29,30)(H,31,34)/b4-3+,28-19+ |
| InChIKey | RCFKXBNQHZOGGA-NMOITACYSA-N |
| XLogP | 3.22 |
| TPSA | 141.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|