C27H37N5O3 — CID 89388147
[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate (PubChem CID 89388147) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is [4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate.
| Compound Name | [4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate |
|---|---|
| PubChem CID | 89388147 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | [4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2S,3S)-2-(3-carbamimidoyl-N-methylanilino)-3-methylpentanoate |
| SMILES | [H]/N=C(\N)c1cccc(N(C)[C@H](C(=O)Oc2ccc(OC3CCN(/C(C)=N/[H])CC3)cc2)[C@@H](C)CC)c1 |
| InChI | InChI=1S/C27H37N5O3/c1-5-18(2)25(31(4)21-8-6-7-20(17-21)26(29)30)27(33)35-23-11-9-22(10-12-23)34-24-13-15-32(16-14-24)19(3)28/h6-12,17-18,24-25,28H,5,13-16H2,1-4H3,(H3,29,30)/b28-19+/t18-,25-/m0/s1 |
| InChIKey | JYFDRYSSHNLFBM-VLYKXYPLSA-N |
| XLogP | 4.27 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|