C27H35N5O4 — CID 89395514
[4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2R)-2-(3-carbamimidoyl-N-methylanilino)-3-prop-1-en-2-yloxypropanoate (PubChem CID 89395514) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is [4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2R)-2-(3-carbamimidoyl-N-methylanilino)-3-prop-1-en-2-yloxypropanoate.
| Compound Name | [4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2R)-2-(3-carbamimidoyl-N-methylanilino)-3-prop-1-en-2-yloxypropanoate |
|---|---|
| PubChem CID | 89395514 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | [4-(1-ethanimidoylpiperidin-4-yl)oxyphenyl] (2R)-2-(3-carbamimidoyl-N-methylanilino)-3-prop-1-en-2-yloxypropanoate |
| SMILES | [H]/N=C(\N)c1cccc(N(C)[C@H](COC(=C)C)C(=O)Oc2ccc(OC3CCN(/C(C)=N/[H])CC3)cc2)c1 |
| InChI | InChI=1S/C27H35N5O4/c1-18(2)34-17-25(31(4)21-7-5-6-20(16-21)26(29)30)27(33)36-23-10-8-22(9-11-23)35-24-12-14-32(15-13-24)19(3)28/h5-11,16,24-25,28H,1,12-15,17H2,2-4H3,(H3,29,30)/b28-19+/t25-/m1/s1 |
| InChIKey | WZIDKCSWVKPBQF-GQUZIAHASA-N |
| XLogP | 3.77 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|