About (4-butoxycarbonylphenyl) piperidine-1-carboxylate
(4-butoxycarbonylphenyl) piperidine-1-carboxylate (PubChem CID 13371959) has the molecular formula C17H23NO4
and a molecular weight of 305.37 g/mol. Its IUPAC name is (4-butoxycarbonylphenyl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (4-butoxycarbonylphenyl) piperidine-1-carboxylate |
| PubChem CID | 13371959 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | (4-butoxycarbonylphenyl) piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)c1ccc(OC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C17H23NO4/c1-2-3-13-21-16(19)14-7-9-15(10-8-14)22-17(20)18-11-5-4-6-12-18/h7-10H,2-6,11-13H2,1H3 |
| InChIKey | OEZQSUXOLWRXQW-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4-butoxycarbonylphenyl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butoxycarbonylphenyl) piperidine-1-carboxylate?
The IUPAC name of (4-butoxycarbonylphenyl) piperidine-1-carboxylate (CID 13371959) is (4-butoxycarbonylphenyl) piperidine-1-carboxylate.
What is the SMILES notation for (4-butoxycarbonylphenyl) piperidine-1-carboxylate?
The canonical SMILES for (4-butoxycarbonylphenyl) piperidine-1-carboxylate is CCCCOC(=O)c1ccc(OC(=O)N2CCCCC2)cc1.
What is the InChIKey of (4-butoxycarbonylphenyl) piperidine-1-carboxylate?
The InChIKey is OEZQSUXOLWRXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23NO4/c1-2-3-13-21-16(19)14-7-9-15(10-8-14)22-17(20)18-11-5-4-6-12-18/h7-10H,2-6,11-13H2,1H3.
What are the key properties of (4-butoxycarbonylphenyl) piperidine-1-carboxylate?
(4-butoxycarbonylphenyl) piperidine-1-carboxylate has a molecular weight of 305.37 g/mol, XLogP of 3.63, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butoxycarbonylphenyl) piperidine-1-carboxylate is sourced from PubChem (CID 13371959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).