C38H55NO7 — CID 14473784
1-O-[4-(4-decoxyphenoxy)carbonylphenyl] 4-O-octyl piperidine-1,4-dicarboxylate (PubChem CID 14473784) has the molecular formula C38H55NO7 and a molecular weight of 637.86 g/mol. Its IUPAC name is 1-O-[4-(4-decoxyphenoxy)carbonylphenyl] 4-O-octyl piperidine-1,4-dicarboxylate.
| Compound Name | 1-O-[4-(4-decoxyphenoxy)carbonylphenyl] 4-O-octyl piperidine-1,4-dicarboxylate |
|---|---|
| PubChem CID | 14473784 |
| Molecular Formula | C38H55NO7 |
| Molecular Weight | 637.86 g/mol |
| Exact Mass | 637.40 |
| IUPAC Name | 1-O-[4-(4-decoxyphenoxy)carbonylphenyl] 4-O-octyl piperidine-1,4-dicarboxylate |
| SMILES | CCCCCCCCCCOc1ccc(OC(=O)c2ccc(OC(=O)N3CCC(C(=O)OCCCCCCCC)CC3)cc2)cc1 |
| InChI | InChI=1S/C38H55NO7/c1-3-5-7-9-11-12-14-15-29-43-33-21-23-34(24-22-33)45-37(41)31-17-19-35(20-18-31)46-38(42)39-27-25-32(26-28-39)36(40)44-30-16-13-10-8-6-4-2/h17-24,32H,3-16,25-30H2,1-2H3 |
| InChIKey | UTJMPGPMSYXDMB-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.86 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|