C30H44N4O3S — CID 100942192
3-[(2S)-3-oxo-3-piperidin-1-yl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propyl]benzenecarboximidamide (PubChem CID 100942192) has the molecular formula C30H44N4O3S and a molecular weight of 540.77 g/mol. Its IUPAC name is 3-[(2S)-3-oxo-3-piperidin-1-yl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propyl]benzenecarboximidamide.
| Compound Name | 3-[(2S)-3-oxo-3-piperidin-1-yl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 100942192 |
| Molecular Formula | C30H44N4O3S |
| Molecular Weight | 540.77 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | 3-[(2S)-3-oxo-3-piperidin-1-yl-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)C(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C30H44N4O3S/c1-19(2)24-17-25(20(3)4)28(26(18-24)21(5)6)38(36,37)33-27(30(35)34-13-8-7-9-14-34)16-22-11-10-12-23(15-22)29(31)32/h10-12,15,17-21,27,33H,7-9,13-14,16H2,1-6H3,(H3,31,32)/t27-/m0/s1 |
| InChIKey | KQJFAHLTPFDWFI-MHZLTWQESA-N |
| XLogP | 5.24 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.77 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|