C42H64N6O9S — CID 136635872
ethyl 4-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoyl]piperazine-1-carboxylate (PubChem CID 136635872) has the molecular formula C42H64N6O9S and a molecular weight of 829.07 g/mol. Its IUPAC name is ethyl 4-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 136635872 |
| Molecular Formula | C42H64N6O9S |
| Molecular Weight | 829.07 g/mol |
| Exact Mass | 828.45 |
| IUPAC Name | ethyl 4-[3-[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]-2-[[2,4,6-tri(propan-2-yl)phenyl]sulfonylamino]propanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C(Cc2cccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c2)NS(=O)(=O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)CC1 |
| InChI | InChI=1S/C42H64N6O9S/c1-14-55-40(52)48-20-18-47(19-21-48)36(49)34(46-58(53,54)35-32(27(4)5)24-30(26(2)3)25-33(35)28(6)7)23-29-16-15-17-31(22-29)43-37(44-38(50)56-41(8,9)10)45-39(51)57-42(11,12)13/h15-17,22,24-28,34,46H,14,18-21,23H2,1-13H3,(H2,43,44,45,50,51) |
| InChIKey | QXLBMVIUBLNQAG-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 185.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 829.07 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|