C28H44N4O8 — CID 135924267
[3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]methyl (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 135924267) has the molecular formula C28H44N4O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is [3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]methyl (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]methyl (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 135924267 |
| Molecular Formula | C28H44N4O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | [3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]phenyl]methyl (2R)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | CC(C)[C@@H](NC(=O)OC(C)(C)C)C(=O)OCc1cccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C28H44N4O8/c1-17(2)20(30-23(34)38-26(3,4)5)21(33)37-16-18-13-12-14-19(15-18)29-22(31-24(35)39-27(6,7)8)32-25(36)40-28(9,10)11/h12-15,17,20H,16H2,1-11H3,(H,30,34)(H2,29,31,32,35,36)/t20-/m1/s1 |
| InChIKey | NDJNDZYYDADQGL-HXUWFJFHSA-N |
| XLogP | 5.32 |
| TPSA | 153.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|