C28H38N8O6S — CID 44573274
4-[4-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfonylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperazin-1-yl]-N-methyl-4-oxobutanamide (PubChem CID 44573274) has the molecular formula C28H38N8O6S and a molecular weight of 614.73 g/mol. Its IUPAC name is 4-[4-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfonylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperazin-1-yl]-N-methyl-4-oxobutanamide.
| Compound Name | 4-[4-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfonylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperazin-1-yl]-N-methyl-4-oxobutanamide |
|---|---|
| PubChem CID | 44573274 |
| Molecular Formula | C28H38N8O6S |
| Molecular Weight | 614.73 g/mol |
| Exact Mass | 614.26 |
| IUPAC Name | 4-[4-[(2S)-2-[[3-(3-aminopropanoylamino)phenyl]sulfonylamino]-3-(3-carbamimidoylphenyl)propanoyl]piperazin-1-yl]-N-methyl-4-oxobutanamide |
| SMILES | [H]/N=C(\N)c1cccc(C[C@H](NS(=O)(=O)c2cccc(NC(=O)CCN)c2)C(=O)N2CCN(C(=O)CCC(=O)NC)CC2)c1 |
| InChI | InChI=1S/C28H38N8O6S/c1-32-24(37)8-9-26(39)35-12-14-36(15-13-35)28(40)23(17-19-4-2-5-20(16-19)27(30)31)34-43(41,42)22-7-3-6-21(18-22)33-25(38)10-11-29/h2-7,16,18,23,34H,8-15,17,29H2,1H3,(H3,30,31)(H,32,37)(H,33,38)/t23-/m0/s1 |
| InChIKey | WKQPAVCHSFLNFO-QHCPKHFHSA-N |
| XLogP | -0.66 |
| TPSA | 220.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.73 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|