C19H19ClN2O3 — CID 67671573
ethyl 5-benzyl-3-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride (PubChem CID 67671573) has the molecular formula C19H19ClN2O3 and a molecular weight of 358.83 g/mol. Its IUPAC name is ethyl 5-benzyl-3-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride.
| Compound Name | ethyl 5-benzyl-3-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 67671573 |
| Molecular Formula | C19H19ClN2O3 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | ethyl 5-benzyl-3-carbamimidoyl-1-benzofuran-2-carboxylate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1c(C(=O)OCC)oc2ccc(Cc3ccccc3)cc12 |
| InChI | InChI=1S/C19H18N2O3.ClH/c1-2-23-19(22)17-16(18(20)21)14-11-13(8-9-15(14)24-17)10-12-6-4-3-5-7-12;/h3-9,11H,2,10H2,1H3,(H3,20,21);1H |
| InChIKey | XTHGJFUIZJMSJB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|