C21H22O4 — CID 169244606
ethyl 3-methyl-5-(3-phenylpropoxy)-1-benzofuran-2-carboxylate (PubChem CID 169244606) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is ethyl 3-methyl-5-(3-phenylpropoxy)-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 3-methyl-5-(3-phenylpropoxy)-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 169244606 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | ethyl 3-methyl-5-(3-phenylpropoxy)-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2ccc(OCCCc3ccccc3)cc2c1C |
| InChI | InChI=1S/C21H22O4/c1-3-23-21(22)20-15(2)18-14-17(11-12-19(18)25-20)24-13-7-10-16-8-5-4-6-9-16/h4-6,8-9,11-12,14H,3,7,10,13H2,1-2H3 |
| InChIKey | ORBUDALPVLMBDW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|