C23H22N6O2 — CID 22136751
7-[[3-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide (PubChem CID 22136751) has the molecular formula C23H22N6O2 and a molecular weight of 414.47 g/mol. Its IUPAC name is 7-[[3-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide.
| Compound Name | 7-[[3-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 22136751 |
| Molecular Formula | C23H22N6O2 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 7-[[3-[(4-carbamimidoylphenyl)methyl]-2,5-dioxoimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2CC(=O)N(Cc3ccc4ccc(/C(N)=N/[H])cc4c3)C2=O)cc1 |
| InChI | InChI=1S/C23H22N6O2/c24-21(25)17-5-1-14(2-6-17)11-28-13-20(30)29(23(28)31)12-15-3-4-16-7-8-18(22(26)27)10-19(16)9-15/h1-10H,11-13H2,(H3,24,25)(H3,26,27) |
| InChIKey | SBTKZHAIKLUQJF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 140.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|