C29H27N5O2 — CID 10322788
7-[[3-[(3-aminophenyl)methyl]-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide (PubChem CID 10322788) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is 7-[[3-[(3-aminophenyl)methyl]-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide.
| Compound Name | 7-[[3-[(3-aminophenyl)methyl]-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide |
|---|---|
| PubChem CID | 10322788 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 7-[[3-[(3-aminophenyl)methyl]-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]methyl]naphthalene-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN3C(=O)N(Cc4cccc(N)c4)C(C)(c4ccccc4)C3=O)cc2c1 |
| InChI | InChI=1S/C29H27N5O2/c1-29(24-7-3-2-4-8-24)27(35)33(28(36)34(29)18-19-6-5-9-25(30)15-19)17-20-10-11-21-12-13-22(26(31)32)16-23(21)14-20/h2-16H,17-18,30H2,1H3,(H3,31,32) |
| InChIKey | LYMVERONZPNFJA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 116.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|