C29H32N4O4 — CID 22136757
8-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]octanoic acid (PubChem CID 22136757) has the molecular formula C29H32N4O4 and a molecular weight of 500.60 g/mol. Its IUPAC name is 8-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]octanoic acid.
| Compound Name | 8-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]octanoic acid |
|---|---|
| PubChem CID | 22136757 |
| Molecular Formula | C29H32N4O4 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.24 |
| IUPAC Name | 8-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]octanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN3C(=O)NC(CCCCCCCC(=O)O)(c4ccccc4)C3=O)cc2c1 |
| InChI | InChI=1S/C29H32N4O4/c30-26(31)22-15-14-21-13-12-20(17-23(21)18-22)19-33-27(36)29(32-28(33)37,24-9-5-4-6-10-24)16-8-3-1-2-7-11-25(34)35/h4-6,9-10,12-15,17-18H,1-3,7-8,11,16,19H2,(H3,30,31)(H,32,37)(H,34,35) |
| InChIKey | BZWJNIBNNYDEAO-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|