C26H26N4O4 — CID 22136742
5-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]pentanoic acid (PubChem CID 22136742) has the molecular formula C26H26N4O4 and a molecular weight of 458.52 g/mol. Its IUPAC name is 5-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]pentanoic acid.
| Compound Name | 5-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 22136742 |
| Molecular Formula | C26H26N4O4 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | 5-[1-[(7-carbamimidoylnaphthalen-2-yl)methyl]-2,5-dioxo-4-phenylimidazolidin-4-yl]pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc2ccc(CN3C(=O)NC(CCCCC(=O)O)(c4ccccc4)C3=O)cc2c1 |
| InChI | InChI=1S/C26H26N4O4/c27-23(28)19-12-11-18-10-9-17(14-20(18)15-19)16-30-24(33)26(29-25(30)34,13-5-4-8-22(31)32)21-6-2-1-3-7-21/h1-3,6-7,9-12,14-15H,4-5,8,13,16H2,(H3,27,28)(H,29,34)(H,31,32) |
| InChIKey | ZPLBCYDADVHGPO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|