C26H25N3O5 — CID 19600585
2-[4-[4-(C-ethoxycarbonimidoyl)phenyl]-4-methyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 19600585) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is 2-[4-[4-(C-ethoxycarbonimidoyl)phenyl]-4-methyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[4-[4-(C-ethoxycarbonimidoyl)phenyl]-4-methyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 19600585 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[4-[4-(C-ethoxycarbonimidoyl)phenyl]-4-methyl-3-(naphthalen-2-ylmethyl)-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | [H]/N=C(\OCC)c1ccc(C2(C)C(=O)N(CC(=O)O)C(=O)N2Cc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C26H25N3O5/c1-3-34-23(27)19-10-12-21(13-11-19)26(2)24(32)28(16-22(30)31)25(33)29(26)15-17-8-9-18-6-4-5-7-20(18)14-17/h4-14,27H,3,15-16H2,1-2H3,(H,30,31)/b27-23- |
| InChIKey | YDYMHPNAZPAVSN-VYIQYICTSA-N |
| XLogP | 3.97 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|