C29H22N2O4 — CID 22351192
5-methyl-3-(naphthalene-2-carbonyl)-1-phenacyl-5-phenylimidazolidine-2,4-dione (PubChem CID 22351192) has the molecular formula C29H22N2O4 and a molecular weight of 462.51 g/mol. Its IUPAC name is 5-methyl-3-(naphthalene-2-carbonyl)-1-phenacyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-(naphthalene-2-carbonyl)-1-phenacyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22351192 |
| Molecular Formula | C29H22N2O4 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 5-methyl-3-(naphthalene-2-carbonyl)-1-phenacyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccccc2)C(=O)N(C(=O)c2ccc3ccccc3c2)C(=O)N1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C29H22N2O4/c1-29(24-14-6-3-7-15-24)27(34)31(26(33)23-17-16-20-10-8-9-13-22(20)18-23)28(35)30(29)19-25(32)21-11-4-2-5-12-21/h2-18H,19H2,1H3 |
| InChIKey | NJOKMPLJNULWAI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|