C20H14N2O3 — CID 70203256
3-(naphthalene-2-carbonyl)-1-phenylimidazolidine-2,4-dione (PubChem CID 70203256) has the molecular formula C20H14N2O3 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-(naphthalene-2-carbonyl)-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-(naphthalene-2-carbonyl)-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70203256 |
| Molecular Formula | C20H14N2O3 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 3-(naphthalene-2-carbonyl)-1-phenylimidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccccc2)C(=O)N1C(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C20H14N2O3/c23-18-13-21(17-8-2-1-3-9-17)20(25)22(18)19(24)16-11-10-14-6-4-5-7-15(14)12-16/h1-12H,13H2 |
| InChIKey | HARIIQDLIQCQQR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|