C24H16N2O6 — CID 25164499
benzoyl 4-(3-benzoyl-2,4-dioxoimidazolidin-1-yl)benzoate (PubChem CID 25164499) has the molecular formula C24H16N2O6 and a molecular weight of 428.40 g/mol. Its IUPAC name is benzoyl 4-(3-benzoyl-2,4-dioxoimidazolidin-1-yl)benzoate.
| Compound Name | benzoyl 4-(3-benzoyl-2,4-dioxoimidazolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 25164499 |
| Molecular Formula | C24H16N2O6 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | benzoyl 4-(3-benzoyl-2,4-dioxoimidazolidin-1-yl)benzoate |
| SMILES | O=C(OC(=O)c1ccc(N2CC(=O)N(C(=O)c3ccccc3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H16N2O6/c27-20-15-25(24(31)26(20)21(28)16-7-3-1-4-8-16)19-13-11-18(12-14-19)23(30)32-22(29)17-9-5-2-6-10-17/h1-14H,15H2 |
| InChIKey | WHWOPSDPRAJZQO-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|