C19H16N2O6S — CID 10739742
prop-2-enyl 4-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoate (PubChem CID 10739742) has the molecular formula C19H16N2O6S and a molecular weight of 400.41 g/mol. Its IUPAC name is prop-2-enyl 4-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoate.
| Compound Name | prop-2-enyl 4-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoate |
|---|---|
| PubChem CID | 10739742 |
| Molecular Formula | C19H16N2O6S |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | prop-2-enyl 4-(2,5-dioxo-3-phenylimidazolidin-1-yl)sulfonylbenzoate |
| SMILES | C=CCOC(=O)c1ccc(S(=O)(=O)N2C(=O)CN(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C19H16N2O6S/c1-2-12-27-18(23)14-8-10-16(11-9-14)28(25,26)21-17(22)13-20(19(21)24)15-6-4-3-5-7-15/h2-11H,1,12-13H2 |
| InChIKey | RAQVPIQDRJHWQG-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|